C14H22ClNO — CID 129166611
4-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-3,5-dimethylpiperidin-4-ol (PubChem CID 129166611) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 4-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-3,5-dimethylpiperidin-4-ol.
| Compound Name | 4-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 129166611 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-3,5-dimethylpiperidin-4-ol |
| SMILES | C=C/C=C(Cl)\C=C/CC1(O)C(C)CNCC1C |
| InChI | InChI=1S/C14H22ClNO/c1-4-6-13(15)7-5-8-14(17)11(2)9-16-10-12(14)3/h4-7,11-12,16-17H,1,8-10H2,2-3H3/b7-5-,13-6+ |
| InChIKey | DBHSTEWHYDPHRJ-IILXRZLBSA-N |
| XLogP | 2.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|