C30H38N6O8S — CID 129166651
tert-butyl N-[(5-amino-7,25,25-trioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-13-yl)methyl]-N-methylcarbamate (PubChem CID 129166651) has the molecular formula C30H38N6O8S and a molecular weight of 642.74 g/mol. Its IUPAC name is tert-butyl N-[(5-amino-7,25,25-trioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-13-yl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(5-amino-7,25,25-trioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-13-yl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 129166651 |
| Molecular Formula | C30H38N6O8S |
| Molecular Weight | 642.74 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | tert-butyl N-[(5-amino-7,25,25-trioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-13-yl)methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cccc2c1OCCOCCOCCNS(=O)(=O)c1ccc(cc1)-c1cnc(N)c(n1)C(=O)N2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H38N6O8S/c1-30(2,3)44-29(38)36(4)19-21-6-5-7-23-26(21)43-17-16-42-15-14-41-13-12-33-45(39,40)22-10-8-20(9-11-22)24-18-32-27(31)25(34-24)28(37)35-23/h5-11,18,33H,12-17,19H2,1-4H3,(H2,31,32)(H,35,37) |
| InChIKey | OYAJBDUBISGRTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 184.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|