About 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine
4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine (PubChem CID 129166728) has the molecular formula C15H22ClN
and a molecular weight of 251.80 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine |
| PubChem CID | 129166728 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine |
| SMILES | CCC1(c2ccc(Cl)cc2)CCNCC1(C)C |
| InChI | InChI=1S/C15H22ClN/c1-4-15(9-10-17-11-14(15,2)3)12-5-7-13(16)8-6-12/h5-8,17H,4,9-11H2,1-3H3 |
| InChIKey | VUFYQJONIBEGGI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine?
The IUPAC name of 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine (CID 129166728) is 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine.
What is the SMILES notation for 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine?
The canonical SMILES for 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine is CCC1(c2ccc(Cl)cc2)CCNCC1(C)C.
What is the InChIKey of 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine?
The InChIKey is VUFYQJONIBEGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClN/c1-4-15(9-10-17-11-14(15,2)3)12-5-7-13(16)8-6-12/h5-8,17H,4,9-11H2,1-3H3.
What are the key properties of 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine?
4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine has a molecular weight of 251.80 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-4-ethyl-3,3-dimethylpiperidine is sourced from PubChem (CID 129166728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).