C14H20F4O — CID 129166829
2-fluoro-1-propan-2-yl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene (PubChem CID 129166829) has the molecular formula C14H20F4O and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-fluoro-1-propan-2-yl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene.
| Compound Name | 2-fluoro-1-propan-2-yl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 129166829 |
| Molecular Formula | C14H20F4O |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-fluoro-1-propan-2-yl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene |
| SMILES | CC(C)C1=C(F)C=C(OCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H20F4O/c1-10(2)12-6-5-11(9-13(12)15)19-8-4-3-7-14(16,17)18/h9-10H,3-8H2,1-2H3 |
| InChIKey | XJIXXVPDIBUFTN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|