C12H21N — CID 129166837
(3E)-N,3-dimethyl-N-propan-2-ylhepta-1,3,6-trien-2-amine (PubChem CID 129166837) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3E)-N,3-dimethyl-N-propan-2-ylhepta-1,3,6-trien-2-amine.
| Compound Name | (3E)-N,3-dimethyl-N-propan-2-ylhepta-1,3,6-trien-2-amine |
|---|---|
| PubChem CID | 129166837 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3E)-N,3-dimethyl-N-propan-2-ylhepta-1,3,6-trien-2-amine |
| SMILES | C=CC/C=C(\C)C(=C)N(C)C(C)C |
| InChI | InChI=1S/C12H21N/c1-7-8-9-11(4)12(5)13(6)10(2)3/h7,9-10H,1,5,8H2,2-4,6H3/b11-9+ |
| InChIKey | YTJOOVQZQPVOMU-PKNBQFBNSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|