About 5-tridecan-7-yl-1,2-thiazole
5-tridecan-7-yl-1,2-thiazole (PubChem CID 129166854) has the molecular formula C16H29NS
and a molecular weight of 267.48 g/mol. Its IUPAC name is 5-tridecan-7-yl-1,2-thiazole.
Molecular Properties
| Compound Name | 5-tridecan-7-yl-1,2-thiazole |
| PubChem CID | 129166854 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-tridecan-7-yl-1,2-thiazole |
| SMILES | CCCCCCC(CCCCCC)c1ccns1 |
| InChI | InChI=1S/C16H29NS/c1-3-5-7-9-11-15(12-10-8-6-4-2)16-13-14-17-18-16/h13-15H,3-12H2,1-2H3 |
| InChIKey | QFVOXTWPSQBLNJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-tridecan-7-yl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tridecan-7-yl-1,2-thiazole?
The IUPAC name of 5-tridecan-7-yl-1,2-thiazole (CID 129166854) is 5-tridecan-7-yl-1,2-thiazole.
What is the SMILES notation for 5-tridecan-7-yl-1,2-thiazole?
The canonical SMILES for 5-tridecan-7-yl-1,2-thiazole is CCCCCCC(CCCCCC)c1ccns1.
What is the InChIKey of 5-tridecan-7-yl-1,2-thiazole?
The InChIKey is QFVOXTWPSQBLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NS/c1-3-5-7-9-11-15(12-10-8-6-4-2)16-13-14-17-18-16/h13-15H,3-12H2,1-2H3.
What are the key properties of 5-tridecan-7-yl-1,2-thiazole?
5-tridecan-7-yl-1,2-thiazole has a molecular weight of 267.48 g/mol, XLogP of 6.17, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tridecan-7-yl-1,2-thiazole is sourced from PubChem (CID 129166854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).