C13H19F3O — CID 129166872
1-ethyl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene (PubChem CID 129166872) has the molecular formula C13H19F3O and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-ethyl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene.
| Compound Name | 1-ethyl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 129166872 |
| Molecular Formula | C13H19F3O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-ethyl-4-(5,5,5-trifluoropentoxy)cyclohexa-1,3-diene |
| SMILES | CCC1=CC=C(OCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H19F3O/c1-2-11-5-7-12(8-6-11)17-10-4-3-9-13(14,15)16/h5,7H,2-4,6,8-10H2,1H3 |
| InChIKey | YZRLLGIWOBMCDF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|