C21H18F6O4 — CID 129167026
4-[2-(4-carboxy-3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylbenzoic acid (PubChem CID 129167026) has the molecular formula C21H18F6O4 and a molecular weight of 448.36 g/mol. Its IUPAC name is 4-[2-(4-carboxy-3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylbenzoic acid.
| Compound Name | 4-[2-(4-carboxy-3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 129167026 |
| Molecular Formula | C21H18F6O4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-[2-(4-carboxy-3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C(c2cc(C)c(C(=O)O)c(C)c2)(C(F)(F)F)C(F)(F)F)cc(C)c1C(=O)O |
| InChI | InChI=1S/C21H18F6O4/c1-9-5-13(6-10(2)15(9)17(28)29)19(20(22,23)24,21(25,26)27)14-7-11(3)16(18(30)31)12(4)8-14/h5-8H,1-4H3,(H,28,29)(H,30,31) |
| InChIKey | HUKUVNWUFABHCO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |