C14H15NS — CID 129167141
7-methyl-8,9,11,11a-tetrahydro-3H-cyclohepta[b][1,4]benzothiazine (PubChem CID 129167141) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 7-methyl-8,9,11,11a-tetrahydro-3H-cyclohepta[b][1,4]benzothiazine.
| Compound Name | 7-methyl-8,9,11,11a-tetrahydro-3H-cyclohepta[b][1,4]benzothiazine |
|---|---|
| PubChem CID | 129167141 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 7-methyl-8,9,11,11a-tetrahydro-3H-cyclohepta[b][1,4]benzothiazine |
| SMILES | CC1=C=C2SC3=CCC=CC3NC2=CCC1 |
| InChI | InChI=1S/C14H15NS/c1-10-5-4-7-12-14(9-10)16-13-8-3-2-6-11(13)15-12/h2,6-8,11,15H,3-5H2,1H3 |
| InChIKey | FKKRSLZCFUYLJX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|