C19H29NO2 — CID 129167144
ethyl 4-[1-(benzylamino)cyclohexyl]butanoate (PubChem CID 129167144) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is ethyl 4-[1-(benzylamino)cyclohexyl]butanoate.
| Compound Name | ethyl 4-[1-(benzylamino)cyclohexyl]butanoate |
|---|---|
| PubChem CID | 129167144 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 4-[1-(benzylamino)cyclohexyl]butanoate |
| SMILES | CCOC(=O)CCCC1(NCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H29NO2/c1-2-22-18(21)12-9-15-19(13-7-4-8-14-19)20-16-17-10-5-3-6-11-17/h3,5-6,10-11,20H,2,4,7-9,12-16H2,1H3 |
| InChIKey | NMSOPNIBPIPXND-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |