C11H23N — CID 129167520
2,2,3,5-tetramethyl-4-methylidenehexan-3-amine (PubChem CID 129167520) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 2,2,3,5-tetramethyl-4-methylidenehexan-3-amine.
| Compound Name | 2,2,3,5-tetramethyl-4-methylidenehexan-3-amine |
|---|---|
| PubChem CID | 129167520 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 2,2,3,5-tetramethyl-4-methylidenehexan-3-amine |
| SMILES | C=C(C(C)C)C(C)(N)C(C)(C)C |
| InChI | InChI=1S/C11H23N/c1-8(2)9(3)11(7,12)10(4,5)6/h8H,3,12H2,1-2,4-7H3 |
| InChIKey | DFFAFZZKFMBZTQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|