C16H17ClN6O — CID 129167655
7-chloro-3-[2-(3,4-diaminophenyl)cyclopropyl]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 129167655) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 7-chloro-3-[2-(3,4-diaminophenyl)cyclopropyl]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-chloro-3-[2-(3,4-diaminophenyl)cyclopropyl]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 129167655 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 7-chloro-3-[2-(3,4-diaminophenyl)cyclopropyl]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CN1C(=O)N(C2CC2c2ccc(N)c(N)c2)Cc2cnc(Cl)nc21 |
| InChI | InChI=1S/C16H17ClN6O/c1-22-14-9(6-20-15(17)21-14)7-23(16(22)24)13-5-10(13)8-2-3-11(18)12(19)4-8/h2-4,6,10,13H,5,7,18-19H2,1H3 |
| InChIKey | VJVGBJVBKBKPLF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|