About [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate
[1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate (PubChem CID 129168334) has the molecular formula C15H21F6IO3
and a molecular weight of 490.22 g/mol. Its IUPAC name is [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate.
Molecular Properties
| Compound Name | [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate |
| PubChem CID | 129168334 |
| Molecular Formula | C15H21F6IO3 |
| Molecular Weight | 490.22 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC(CC(O)(C(F)(F)F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C15H21F6IO3/c1-2-10(22)12(23)25-11(9-6-4-3-5-7-9)8-13(24,14(16,17)18)15(19,20)21/h9-11,24H,2-8H2,1H3 |
| InChIKey | LZFVPCDMEJDXST-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.22 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate?
The IUPAC name of [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate (CID 129168334) is [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate.
What is the SMILES notation for [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate?
The canonical SMILES for [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate is CCC(I)C(=O)OC(CC(O)(C(F)(F)F)C(F)(F)F)C1CCCCC1.
What is the InChIKey of [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate?
The InChIKey is LZFVPCDMEJDXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F6IO3/c1-2-10(22)12(23)25-11(9-6-4-3-5-7-9)8-13(24,14(16,17)18)15(19,20)21/h9-11,24H,2-8H2,1H3.
What are the key properties of [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate?
[1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate has a molecular weight of 490.22 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butyl] 2-iodobutanoate is sourced from PubChem (CID 129168334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).