About 1-benzofuran-7-yl 2-iodo-2-methylbutanoate
1-benzofuran-7-yl 2-iodo-2-methylbutanoate (PubChem CID 129168422) has the molecular formula C13H13IO3
and a molecular weight of 344.15 g/mol. Its IUPAC name is 1-benzofuran-7-yl 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | 1-benzofuran-7-yl 2-iodo-2-methylbutanoate |
| PubChem CID | 129168422 |
| Molecular Formula | C13H13IO3 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-benzofuran-7-yl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)Oc1cccc2ccoc12 |
| InChI | InChI=1S/C13H13IO3/c1-3-13(2,14)12(15)17-10-6-4-5-9-7-8-16-11(9)10/h4-8H,3H2,1-2H3 |
| InChIKey | UITPNGSTKWAKCL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-7-yl 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-7-yl 2-iodo-2-methylbutanoate?
The IUPAC name of 1-benzofuran-7-yl 2-iodo-2-methylbutanoate (CID 129168422) is 1-benzofuran-7-yl 2-iodo-2-methylbutanoate.
What is the SMILES notation for 1-benzofuran-7-yl 2-iodo-2-methylbutanoate?
The canonical SMILES for 1-benzofuran-7-yl 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)Oc1cccc2ccoc12.
What is the InChIKey of 1-benzofuran-7-yl 2-iodo-2-methylbutanoate?
The InChIKey is UITPNGSTKWAKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IO3/c1-3-13(2,14)12(15)17-10-6-4-5-9-7-8-16-11(9)10/h4-8H,3H2,1-2H3.
What are the key properties of 1-benzofuran-7-yl 2-iodo-2-methylbutanoate?
1-benzofuran-7-yl 2-iodo-2-methylbutanoate has a molecular weight of 344.15 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-7-yl 2-iodo-2-methylbutanoate is sourced from PubChem (CID 129168422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).