About 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane
6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane (PubChem CID 129168970) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane.
Molecular Properties
| Compound Name | 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane |
| PubChem CID | 129168970 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane |
| SMILES | CN1CCC(CN2CC3(CNC3)C2)OC1 |
| InChI | InChI=1S/C11H21N3O/c1-13-3-2-10(15-9-13)4-14-7-11(8-14)5-12-6-11/h10,12H,2-9H2,1H3 |
| InChIKey | ZYXARWBXQTWORX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane?
The IUPAC name of 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane (CID 129168970) is 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane.
What is the SMILES notation for 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane?
The canonical SMILES for 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane is CN1CCC(CN2CC3(CNC3)C2)OC1.
What is the InChIKey of 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane?
The InChIKey is ZYXARWBXQTWORX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-13-3-2-10(15-9-13)4-14-7-11(8-14)5-12-6-11/h10,12H,2-9H2,1H3.
What are the key properties of 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane?
6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane has a molecular weight of 211.31 g/mol, XLogP of -0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-diazaspiro[3.3]heptan-2-ylmethyl)-3-methyl-1,3-oxazinane is sourced from PubChem (CID 129168970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).