C14H22O2 — CID 129168986
3,6-dimethyl-5,6,7,8,9,10,11,11a-octahydro-3aH-cyclodeca[b]furan-4-one (PubChem CID 129168986) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 3,6-dimethyl-5,6,7,8,9,10,11,11a-octahydro-3aH-cyclodeca[b]furan-4-one.
| Compound Name | 3,6-dimethyl-5,6,7,8,9,10,11,11a-octahydro-3aH-cyclodeca[b]furan-4-one |
|---|---|
| PubChem CID | 129168986 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 3,6-dimethyl-5,6,7,8,9,10,11,11a-octahydro-3aH-cyclodeca[b]furan-4-one |
| SMILES | CC1=COC2CCCCCC(C)CC(=O)C12 |
| InChI | InChI=1S/C14H22O2/c1-10-6-4-3-5-7-13-14(12(15)8-10)11(2)9-16-13/h9-10,13-14H,3-8H2,1-2H3 |
| InChIKey | CDVLDVXKQVXNOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |