About 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole
2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole (PubChem CID 129169156) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole |
| PubChem CID | 129169156 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole |
| SMILES | CC(CCC(C)c1nnco1)c1ccon1 |
| InChI | InChI=1S/C11H15N3O2/c1-8(10-5-6-16-14-10)3-4-9(2)11-13-12-7-15-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | YCBPUXSCMMFNCU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole?
The IUPAC name of 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole (CID 129169156) is 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole.
What is the SMILES notation for 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole?
The canonical SMILES for 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole is CC(CCC(C)c1nnco1)c1ccon1.
What is the InChIKey of 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole?
The InChIKey is YCBPUXSCMMFNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c1-8(10-5-6-16-14-10)3-4-9(2)11-13-12-7-15-11/h5-9H,3-4H2,1-2H3.
What are the key properties of 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole?
2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole has a molecular weight of 221.26 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,2-oxazol-3-yl)hexan-2-yl]-1,3,4-oxadiazole is sourced from PubChem (CID 129169156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).