About 5-methylcyclohex-3-ene-1,2-diimine
5-methylcyclohex-3-ene-1,2-diimine (PubChem CID 129169331) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 5-methylcyclohex-3-ene-1,2-diimine.
Molecular Properties
| Compound Name | 5-methylcyclohex-3-ene-1,2-diimine |
| PubChem CID | 129169331 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 5-methylcyclohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=CC(C)C\C1=N/[H] |
| InChI | InChI=1S/C7H10N2/c1-5-2-3-6(8)7(9)4-5/h2-3,5,8-9H,4H2,1H3/b8-6+,9-7+ |
| InChIKey | FOKRNXZCZMEXCL-CDJQDVQCSA-N |
| XLogP | 1.62 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methylcyclohex-3-ene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylcyclohex-3-ene-1,2-diimine?
The IUPAC name of 5-methylcyclohex-3-ene-1,2-diimine (CID 129169331) is 5-methylcyclohex-3-ene-1,2-diimine.
What is the SMILES notation for 5-methylcyclohex-3-ene-1,2-diimine?
The canonical SMILES for 5-methylcyclohex-3-ene-1,2-diimine is [H]/N=C1\C=CC(C)C\C1=N/[H].
What is the InChIKey of 5-methylcyclohex-3-ene-1,2-diimine?
The InChIKey is FOKRNXZCZMEXCL-CDJQDVQCSA-N. The full InChI is InChI=1S/C7H10N2/c1-5-2-3-6(8)7(9)4-5/h2-3,5,8-9H,4H2,1H3/b8-6+,9-7+.
What are the key properties of 5-methylcyclohex-3-ene-1,2-diimine?
5-methylcyclohex-3-ene-1,2-diimine has a molecular weight of 122.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylcyclohex-3-ene-1,2-diimine is sourced from PubChem (CID 129169331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).