About 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline
3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline (PubChem CID 129169813) has the molecular formula C15H14FN5
and a molecular weight of 283.31 g/mol. Its IUPAC name is 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline.
Molecular Properties
| Compound Name | 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline |
| PubChem CID | 129169813 |
| Molecular Formula | C15H14FN5 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline |
| SMILES | Cc1cc(F)ncc1-c1ccc2c(c1)=CNC(N=NN)C=2 |
| InChI | InChI=1S/C15H14FN5/c1-9-4-14(16)18-8-13(9)11-3-2-10-6-15(20-21-17)19-7-12(10)5-11/h2-8,15,19H,1H3,(H2,17,20) |
| InChIKey | GCUHOTHAXFWKJL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline?
The IUPAC name of 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline (CID 129169813) is 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline.
What is the SMILES notation for 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline?
The canonical SMILES for 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline is Cc1cc(F)ncc1-c1ccc2c(c1)=CNC(N=NN)C=2.
What is the InChIKey of 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline?
The InChIKey is GCUHOTHAXFWKJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN5/c1-9-4-14(16)18-8-13(9)11-3-2-10-6-15(20-21-17)19-7-12(10)5-11/h2-8,15,19H,1H3,(H2,17,20).
What are the key properties of 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline?
3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline has a molecular weight of 283.31 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminodiazenyl)-7-(6-fluoro-4-methyl-3-pyridinyl)-2,3-dihydroisoquinoline is sourced from PubChem (CID 129169813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).