C19H26N2 — CID 129169935
(1Z,3Z)-N-methyl-1-[(3Z,4Z)-3-[(methylideneamino)methylidene]-4-pentylidenecyclohexa-1,5-dien-1-yl]penta-1,3-dien-1-amine (PubChem CID 129169935) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (1Z,3Z)-N-methyl-1-[(3Z,4Z)-3-[(methylideneamino)methylidene]-4-pentylidenecyclohexa-1,5-dien-1-yl]penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-N-methyl-1-[(3Z,4Z)-3-[(methylideneamino)methylidene]-4-pentylidenecyclohexa-1,5-dien-1-yl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 129169935 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (1Z,3Z)-N-methyl-1-[(3Z,4Z)-3-[(methylideneamino)methylidene]-4-pentylidenecyclohexa-1,5-dien-1-yl]penta-1,3-dien-1-amine |
| SMILES | C=N/C=c1/cc(/C(=C/C=C\C)NC)cc/c1=C/CCCC |
| InChI | InChI=1S/C19H26N2/c1-5-7-9-10-16-12-13-17(14-18(16)15-20-3)19(21-4)11-8-6-2/h6,8,10-15,21H,3,5,7,9H2,1-2,4H3/b8-6-,16-10-,18-15-,19-11- |
| InChIKey | UVKLFLLEMMIHMT-QSQQMOECSA-N |
| XLogP | 3.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|