About 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol
2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol (PubChem CID 129170393) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol |
| PubChem CID | 129170393 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol |
| SMILES | CC1=CC(C(C)(C)O)=CC(C)N1 |
| InChI | InChI=1S/C10H17NO/c1-7-5-9(10(3,4)12)6-8(2)11-7/h5-7,11-12H,1-4H3 |
| InChIKey | ZZGINUQQVZVMRX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol?
The IUPAC name of 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol (CID 129170393) is 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol.
What is the SMILES notation for 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol?
The canonical SMILES for 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol is CC1=CC(C(C)(C)O)=CC(C)N1.
What is the InChIKey of 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol?
The InChIKey is ZZGINUQQVZVMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-7-5-9(10(3,4)12)6-8(2)11-7/h5-7,11-12H,1-4H3.
What are the key properties of 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol?
2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol has a molecular weight of 167.25 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethyl-1,2-dihydropyridin-4-yl)propan-2-ol is sourced from PubChem (CID 129170393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).