C18H25N3 — CID 129170511
(2E,4Z)-5-[(4E)-4-(2-ethenyliminopropylidene)cyclohexa-1,5-dien-1-yl]hepta-2,4-diene-3,4-diamine (PubChem CID 129170511) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is (2E,4Z)-5-[(4E)-4-(2-ethenyliminopropylidene)cyclohexa-1,5-dien-1-yl]hepta-2,4-diene-3,4-diamine.
| Compound Name | (2E,4Z)-5-[(4E)-4-(2-ethenyliminopropylidene)cyclohexa-1,5-dien-1-yl]hepta-2,4-diene-3,4-diamine |
|---|---|
| PubChem CID | 129170511 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | (2E,4Z)-5-[(4E)-4-(2-ethenyliminopropylidene)cyclohexa-1,5-dien-1-yl]hepta-2,4-diene-3,4-diamine |
| SMILES | C=C/N=C(C)/C=C1/C=CC(/C(CC)=C(N)/C(N)=C\C)=CC1 |
| InChI | InChI=1S/C18H25N3/c1-5-16(18(20)17(19)6-2)15-10-8-14(9-11-15)12-13(4)21-7-3/h6-8,10-12H,3,5,9,19-20H2,1-2,4H3/b14-12-,17-6+,18-16-,21-13+ |
| InChIKey | DETPWGFQJQFRPG-ARWYFTCPSA-N |
| XLogP | 3.89 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|