C8H12F2O — CID 129171108
2,3-difluoro-1-methoxy-4-methylidenecyclohexane (PubChem CID 129171108) has the molecular formula C8H12F2O and a molecular weight of 162.18 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-methylidenecyclohexane.
| Compound Name | 2,3-difluoro-1-methoxy-4-methylidenecyclohexane |
|---|---|
| PubChem CID | 129171108 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-methylidenecyclohexane |
| SMILES | C=C1CCC(OC)C(F)C1F |
| InChI | InChI=1S/C8H12F2O/c1-5-3-4-6(11-2)8(10)7(5)9/h6-8H,1,3-4H2,2H3 |
| InChIKey | UMCRRZFUIOAGDC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|