About (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine
(Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine (PubChem CID 129171164) has the molecular formula C10H17ClN2
and a molecular weight of 200.71 g/mol. Its IUPAC name is (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine.
Molecular Properties
| Compound Name | (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine |
| PubChem CID | 129171164 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine |
| SMILES | CC/N=C/C(=C/CC/C=N/C)CCl |
| InChI | InChI=1S/C10H17ClN2/c1-3-13-9-10(8-11)6-4-5-7-12-2/h6-7,9H,3-5,8H2,1-2H3/b10-6+,12-7+,13-9+ |
| InChIKey | UWDLCEHSGTVDRF-WZPAWBLDSA-N |
| XLogP | 2.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine?
The IUPAC name of (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine (CID 129171164) is (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine.
What is the SMILES notation for (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine?
The canonical SMILES for (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine is CC/N=C/C(=C/CC/C=N/C)CCl.
What is the InChIKey of (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine?
The InChIKey is UWDLCEHSGTVDRF-WZPAWBLDSA-N. The full InChI is InChI=1S/C10H17ClN2/c1-3-13-9-10(8-11)6-4-5-7-12-2/h6-7,9H,3-5,8H2,1-2H3/b10-6+,12-7+,13-9+.
What are the key properties of (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine?
(Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine has a molecular weight of 200.71 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(chloromethyl)-N-ethyl-N'-methylhex-2-ene-1,6-diimine is sourced from PubChem (CID 129171164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).