C14H23N — CID 129171196
(3Z,5E)-5-tert-butyl-7-methyl-2,7,8,9-tetrahydroazecine (PubChem CID 129171196) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3Z,5E)-5-tert-butyl-7-methyl-2,7,8,9-tetrahydroazecine.
| Compound Name | (3Z,5E)-5-tert-butyl-7-methyl-2,7,8,9-tetrahydroazecine |
|---|---|
| PubChem CID | 129171196 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3Z,5E)-5-tert-butyl-7-methyl-2,7,8,9-tetrahydroazecine |
| SMILES | CC1/C=C(C(C)(C)C)\C=C/C/N=C\CC1 |
| InChI | InChI=1S/C14H23N/c1-12-7-5-9-15-10-6-8-13(11-12)14(2,3)4/h6,8-9,11-12H,5,7,10H2,1-4H3/b8-6-,13-11+,15-9- |
| InChIKey | XXMOYBJBEYOFEA-SDGYBTMASA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |