About (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide
(2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide (PubChem CID 129171218) has the molecular formula C12H21ClN2
and a molecular weight of 228.77 g/mol. Its IUPAC name is (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide.
Molecular Properties
| Compound Name | (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide |
| PubChem CID | 129171218 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide |
| SMILES | C/C=C(CCC)/C(=N\C/C=C/Cl)NCC |
| InChI | InChI=1S/C12H21ClN2/c1-4-8-11(5-2)12(14-6-3)15-10-7-9-13/h5,7,9H,4,6,8,10H2,1-3H3,(H,14,15)/b9-7+,11-5+ |
| InChIKey | WGHHPLQTEBHWIC-SWTGVTSMSA-N |
| XLogP | 3.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide?
The IUPAC name of (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide (CID 129171218) is (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide.
What is the SMILES notation for (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide?
The canonical SMILES for (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide is C/C=C(CCC)/C(=N\C/C=C/Cl)NCC.
What is the InChIKey of (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide?
The InChIKey is WGHHPLQTEBHWIC-SWTGVTSMSA-N. The full InChI is InChI=1S/C12H21ClN2/c1-4-8-11(5-2)12(14-6-3)15-10-7-9-13/h5,7,9H,4,6,8,10H2,1-3H3,(H,14,15)/b9-7+,11-5+.
What are the key properties of (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide?
(2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide has a molecular weight of 228.77 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N'-[(E)-3-chloroprop-2-enyl]-N-ethyl-2-ethylidenepentanimidamide is sourced from PubChem (CID 129171218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).