About 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine
1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine (PubChem CID 129171315) has the molecular formula C4H4BrIN2S
and a molecular weight of 318.97 g/mol. Its IUPAC name is 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine.
Molecular Properties
| Compound Name | 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine |
| PubChem CID | 129171315 |
| Molecular Formula | C4H4BrIN2S |
| Molecular Weight | 318.97 g/mol |
| Exact Mass | 317.83 |
| IUPAC Name | 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine |
| SMILES | Brc1csc(CNI)n1 |
| InChI | InChI=1S/C4H4BrIN2S/c5-3-2-9-4(8-3)1-7-6/h2,7H,1H2 |
| InChIKey | SHCRYALUIVBSGM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.97 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine?
The IUPAC name of 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine (CID 129171315) is 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine.
What is the SMILES notation for 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine?
The canonical SMILES for 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine is Brc1csc(CNI)n1.
What is the InChIKey of 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine?
The InChIKey is SHCRYALUIVBSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrIN2S/c5-3-2-9-4(8-3)1-7-6/h2,7H,1H2.
What are the key properties of 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine?
1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine has a molecular weight of 318.97 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-1,3-thiazol-2-yl)-N-iodomethanamine is sourced from PubChem (CID 129171315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).