About 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid
2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid (PubChem CID 129171626) has the molecular formula C11H13NO2S
and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid |
| PubChem CID | 129171626 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid |
| SMILES | CC1=NC2C=C(CC(=O)O)C=CC(C2)S1 |
| InChI | InChI=1S/C11H13NO2S/c1-7-12-9-4-8(5-11(13)14)2-3-10(6-9)15-7/h2-4,9-10H,5-6H2,1H3,(H,13,14) |
| InChIKey | UOZRVPRLYGBNAN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid?
The IUPAC name of 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid (CID 129171626) is 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid.
What is the SMILES notation for 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid?
The canonical SMILES for 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid is CC1=NC2C=C(CC(=O)O)C=CC(C2)S1.
What is the InChIKey of 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid?
The InChIKey is UOZRVPRLYGBNAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c1-7-12-9-4-8(5-11(13)14)2-3-10(6-9)15-7/h2-4,9-10H,5-6H2,1H3,(H,13,14).
What are the key properties of 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid?
2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid has a molecular weight of 223.30 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methyl-7-thia-9-azabicyclo[4.3.1]deca-2,4,8-trien-3-yl)acetic acid is sourced from PubChem (CID 129171626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).