About 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid
4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid (PubChem CID 129171886) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid |
| PubChem CID | 129171886 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid |
| SMILES | CC1CC=Cc2c(Br)cnc(C(=O)O)c21 |
| InChI | InChI=1S/C11H10BrNO2/c1-6-3-2-4-7-8(12)5-13-10(9(6)7)11(14)15/h2,4-6H,3H2,1H3,(H,14,15) |
| InChIKey | SBUKSIJXFXRLMT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid?
The IUPAC name of 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid (CID 129171886) is 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid.
What is the SMILES notation for 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid?
The canonical SMILES for 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid is CC1CC=Cc2c(Br)cnc(C(=O)O)c21.
What is the InChIKey of 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid?
The InChIKey is SBUKSIJXFXRLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO2/c1-6-3-2-4-7-8(12)5-13-10(9(6)7)11(14)15/h2,4-6H,3H2,1H3,(H,14,15).
What are the key properties of 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid?
4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid has a molecular weight of 268.11 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-8-methyl-7,8-dihydroisoquinoline-1-carboxylic acid is sourced from PubChem (CID 129171886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).