C11H15NO — CID 129172060
1-(2-methyl-1,3,6,7-tetrahydroisoindol-1-yl)ethanone (PubChem CID 129172060) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(2-methyl-1,3,6,7-tetrahydroisoindol-1-yl)ethanone.
| Compound Name | 1-(2-methyl-1,3,6,7-tetrahydroisoindol-1-yl)ethanone |
|---|---|
| PubChem CID | 129172060 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-(2-methyl-1,3,6,7-tetrahydroisoindol-1-yl)ethanone |
| SMILES | CC(=O)C1C2=C(C=CCC2)CN1C |
| InChI | InChI=1S/C11H15NO/c1-8(13)11-10-6-4-3-5-9(10)7-12(11)2/h3,5,11H,4,6-7H2,1-2H3 |
| InChIKey | ZAWXQCJCCDKFBI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |