About N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine
N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine (PubChem CID 129172083) has the molecular formula C12H20FN
and a molecular weight of 197.30 g/mol. Its IUPAC name is N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine.
Molecular Properties
| Compound Name | N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine |
| PubChem CID | 129172083 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C(\C=C(\F)CCC)CCC |
| InChI | InChI=1S/C12H20FN/c1-4-7-11(10-14-6-3)9-12(13)8-5-2/h6,9-10H,4-5,7-8H2,1-3H3/b11-10-,12-9+,14-6+ |
| InChIKey | YSCVMERIORZBHI-UBLOARBOSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine?
The IUPAC name of N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine (CID 129172083) is N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine.
What is the SMILES notation for N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine?
The canonical SMILES for N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine is C/C=N/C=C(\C=C(\F)CCC)CCC.
What is the InChIKey of N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine?
The InChIKey is YSCVMERIORZBHI-UBLOARBOSA-N. The full InChI is InChI=1S/C12H20FN/c1-4-7-11(10-14-6-3)9-12(13)8-5-2/h6,9-10H,4-5,7-8H2,1-3H3/b11-10-,12-9+,14-6+.
What are the key properties of N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine?
N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine has a molecular weight of 197.30 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z,3E)-4-fluoro-2-propylhepta-1,3-dienyl]ethanimine is sourced from PubChem (CID 129172083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).