About 2-hydroxy-N'-methylbutanediamide
2-hydroxy-N'-methylbutanediamide (PubChem CID 129172569) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-hydroxy-N'-methylbutanediamide.
Molecular Properties
| Compound Name | 2-hydroxy-N'-methylbutanediamide |
| PubChem CID | 129172569 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2-hydroxy-N'-methylbutanediamide |
| SMILES | CNC(=O)CC(O)C(N)=O |
| InChI | InChI=1S/C5H10N2O3/c1-7-4(9)2-3(8)5(6)10/h3,8H,2H2,1H3,(H2,6,10)(H,7,9) |
| InChIKey | AFNFTEAHFDHSIZ-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N'-methylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N'-methylbutanediamide?
The IUPAC name of 2-hydroxy-N'-methylbutanediamide (CID 129172569) is 2-hydroxy-N'-methylbutanediamide.
What is the SMILES notation for 2-hydroxy-N'-methylbutanediamide?
The canonical SMILES for 2-hydroxy-N'-methylbutanediamide is CNC(=O)CC(O)C(N)=O.
What is the InChIKey of 2-hydroxy-N'-methylbutanediamide?
The InChIKey is AFNFTEAHFDHSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c1-7-4(9)2-3(8)5(6)10/h3,8H,2H2,1H3,(H2,6,10)(H,7,9).
What are the key properties of 2-hydroxy-N'-methylbutanediamide?
2-hydroxy-N'-methylbutanediamide has a molecular weight of 146.15 g/mol, XLogP of -2.03, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N'-methylbutanediamide is sourced from PubChem (CID 129172569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).