About dibenzothiophen-3-amine
dibenzothiophen-3-amine (PubChem CID 129172898) has the molecular formula C12H7NS
and a molecular weight of 197.26 g/mol. Its IUPAC name is dibenzothiophen-3-amine.
Molecular Properties
| Compound Name | dibenzothiophen-3-amine |
| PubChem CID | 129172898 |
| Molecular Formula | C12H7NS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | dibenzothiophen-3-amine |
| SMILES | Nc1ccc2c3c(sc2c1)=CC=C=C=3 |
| InChI | InChI=1S/C12H7NS/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h2,4-7H,13H2 |
| InChIKey | YWVPDKGGKKGSIU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dibenzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophen-3-amine?
The IUPAC name of dibenzothiophen-3-amine (CID 129172898) is dibenzothiophen-3-amine.
What is the SMILES notation for dibenzothiophen-3-amine?
The canonical SMILES for dibenzothiophen-3-amine is Nc1ccc2c3c(sc2c1)=CC=C=C=3.
What is the InChIKey of dibenzothiophen-3-amine?
The InChIKey is YWVPDKGGKKGSIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NS/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h2,4-7H,13H2.
What are the key properties of dibenzothiophen-3-amine?
dibenzothiophen-3-amine has a molecular weight of 197.26 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophen-3-amine is sourced from PubChem (CID 129172898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).