C26H29NO2S — CID 129173148
N-(4-hydroxy-2-methylpentyl)-4-[2-(2-methylphenyl)phenyl]sulfanylbenzamide (PubChem CID 129173148) has the molecular formula C26H29NO2S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylpentyl)-4-[2-(2-methylphenyl)phenyl]sulfanylbenzamide.
| Compound Name | N-(4-hydroxy-2-methylpentyl)-4-[2-(2-methylphenyl)phenyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 129173148 |
| Molecular Formula | C26H29NO2S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-(4-hydroxy-2-methylpentyl)-4-[2-(2-methylphenyl)phenyl]sulfanylbenzamide |
| SMILES | Cc1ccccc1-c1ccccc1Sc1ccc(C(=O)NCC(C)CC(C)O)cc1 |
| InChI | InChI=1S/C26H29NO2S/c1-18(16-20(3)28)17-27-26(29)21-12-14-22(15-13-21)30-25-11-7-6-10-24(25)23-9-5-4-8-19(23)2/h4-15,18,20,28H,16-17H2,1-3H3,(H,27,29) |
| InChIKey | KJWUBLXYYHUUDL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |