C23H21F3N4O4 — CID 129173992
N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxo-4a,8a-dihydroquinazolin-5-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 129173992) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxo-4a,8a-dihydroquinazolin-5-yl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxo-4a,8a-dihydroquinazolin-5-yl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129173992 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxo-4a,8a-dihydroquinazolin-5-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC1=NC2C=CC=C(CNC(=O)c3ccc(C(F)(F)F)cc3)C2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H21F3N4O4/c1-12-28-16-4-2-3-14(11-27-20(32)13-5-7-15(8-6-13)23(24,25)26)19(16)22(34)30(12)17-9-10-18(31)29-21(17)33/h2-8,16-17,19H,9-11H2,1H3,(H,27,32)(H,29,31,33) |
| InChIKey | BAEBQMPUNUSFOV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|