C36H11F11N2 — CID 129174119
2-[4-(1,3,4,5,6,7,8,9,10,11,12-undecafluorotriphenylen-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 129174119) has the molecular formula C36H11F11N2 and a molecular weight of 680.48 g/mol. Its IUPAC name is 2-[4-(1,3,4,5,6,7,8,9,10,11,12-undecafluorotriphenylen-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 2-[4-(1,3,4,5,6,7,8,9,10,11,12-undecafluorotriphenylen-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 129174119 |
| Molecular Formula | C36H11F11N2 |
| Molecular Weight | 680.48 g/mol |
| Exact Mass | 680.07 |
| IUPAC Name | 2-[4-(1,3,4,5,6,7,8,9,10,11,12-undecafluorotriphenylen-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | Fc1c(F)c(F)c2c(c1F)c1c(F)c(F)c(F)c(F)c1c1c(F)c(-c3ccc(-c4ccc5ccc6cccnc6c5n4)cc3)c(F)c(F)c21 |
| InChI | InChI=1S/C36H11F11N2/c37-24-17(13-5-3-12(4-6-13)16-10-9-15-8-7-14-2-1-11-48-35(14)36(15)49-16)25(38)26(39)19-18(24)20-22(29(42)33(46)31(44)27(20)40)23-21(19)28(41)32(45)34(47)30(23)43/h1-11H |
| InChIKey | BZMCDFLXLGRQHC-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.48 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|