C20H15I — CID 129174339
10-iodo-9-phenyl-4a,10-dihydroanthracene (PubChem CID 129174339) has the molecular formula C20H15I and a molecular weight of 382.24 g/mol. Its IUPAC name is 10-iodo-9-phenyl-4a,10-dihydroanthracene.
| Compound Name | 10-iodo-9-phenyl-4a,10-dihydroanthracene |
|---|---|
| PubChem CID | 129174339 |
| Molecular Formula | C20H15I |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 10-iodo-9-phenyl-4a,10-dihydroanthracene |
| SMILES | IC1c2ccccc2C(c2ccccc2)=C2C=CC=CC21 |
| InChI | InChI=1S/C20H15I/c21-20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h1-13,17,20H |
| InChIKey | UHEBFYJSGNQDME-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|