About 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene
9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene (PubChem CID 129174445) has the molecular formula C21H19I
and a molecular weight of 398.29 g/mol. Its IUPAC name is 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene.
Molecular Properties
| Compound Name | 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene |
| PubChem CID | 129174445 |
| Molecular Formula | C21H19I |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene |
| SMILES | CC1(c2c3c(c(I)c4ccccc24)=CCCC=3)C=CC=CC1 |
| InChI | InChI=1S/C21H19I/c1-21(13-7-2-8-14-21)19-15-9-3-5-11-17(15)20(22)18-12-6-4-10-16(18)19/h2-3,5,7-13H,4,6,14H2,1H3 |
| InChIKey | ATEPJWPAOZFRNR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene?
The IUPAC name of 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene (CID 129174445) is 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene.
What is the SMILES notation for 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene?
The canonical SMILES for 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene is CC1(c2c3c(c(I)c4ccccc24)=CCCC=3)C=CC=CC1.
What is the InChIKey of 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene?
The InChIKey is ATEPJWPAOZFRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19I/c1-21(13-7-2-8-14-21)19-15-9-3-5-11-17(15)20(22)18-12-6-4-10-16(18)19/h2-3,5,7-13H,4,6,14H2,1H3.
What are the key properties of 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene?
9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene has a molecular weight of 398.29 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-10-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene is sourced from PubChem (CID 129174445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).