C10H11N3 — CID 129174777
N-[(1E,3Z)-2-pyrimidin-5-ylpenta-1,3-dienyl]methanimine (PubChem CID 129174777) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is N-[(1E,3Z)-2-pyrimidin-5-ylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-pyrimidin-5-ylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 129174777 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-[(1E,3Z)-2-pyrimidin-5-ylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)c1cncnc1 |
| InChI | InChI=1S/C10H11N3/c1-3-4-9(5-11-2)10-6-12-8-13-7-10/h3-8H,2H2,1H3/b4-3-,9-5+ |
| InChIKey | SMTATCAXIDQCTF-XBURUKCPSA-N |
| XLogP | 2.09 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|