C12H6F4N2OS2 — CID 129175114
(E)-1-(4-fluorophenyl)-3-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]prop-2-en-1-one (PubChem CID 129175114) has the molecular formula C12H6F4N2OS2 and a molecular weight of 334.32 g/mol. Its IUPAC name is (E)-1-(4-fluorophenyl)-3-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-fluorophenyl)-3-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129175114 |
| Molecular Formula | C12H6F4N2OS2 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | (E)-1-(4-fluorophenyl)-3-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/Sc1nnc(C(F)(F)F)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H6F4N2OS2/c13-8-3-1-7(2-4-8)9(19)5-6-20-11-18-17-10(21-11)12(14,15)16/h1-6H/b6-5+ |
| InChIKey | IMEMIQXIDTUXJB-AATRIKPKSA-N |
| XLogP | 4.18 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|