C20H24O5 — CID 129175910
(6S,7S)-5-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 129175910) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (6S,7S)-5-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6S,7S)-5-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 129175910 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (6S,7S)-5-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(C2c3cc(C)c(O)cc3C[C@H](CO)[C@H]2CO)ccc1O |
| InChI | InChI=1S/C20H24O5/c1-11-5-15-13(7-18(11)24)6-14(9-21)16(10-22)20(15)12-3-4-17(23)19(8-12)25-2/h3-5,7-8,14,16,20-24H,6,9-10H2,1-2H3/t14-,16-,20?/m1/s1 |
| InChIKey | WITLFVTUDMJEIV-BISUUYRGSA-N |
| XLogP | 2.32 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |