C28H32FN5O6S — CID 129177155
butyl 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-prop-2-enoxyethyl]-5-methyl-2,4-dioxo-6-(triazol-2-yl)thieno[2,3-d]pyrimidin-3-yl]propanoate (PubChem CID 129177155) has the molecular formula C28H32FN5O6S and a molecular weight of 585.66 g/mol. Its IUPAC name is butyl 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-prop-2-enoxyethyl]-5-methyl-2,4-dioxo-6-(triazol-2-yl)thieno[2,3-d]pyrimidin-3-yl]propanoate.
| Compound Name | butyl 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-prop-2-enoxyethyl]-5-methyl-2,4-dioxo-6-(triazol-2-yl)thieno[2,3-d]pyrimidin-3-yl]propanoate |
|---|---|
| PubChem CID | 129177155 |
| Molecular Formula | C28H32FN5O6S |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | butyl 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-prop-2-enoxyethyl]-5-methyl-2,4-dioxo-6-(triazol-2-yl)thieno[2,3-d]pyrimidin-3-yl]propanoate |
| SMILES | C=CCO[C@@H](Cn1c(=O)n(C(C)C(=O)OCCCC)c(=O)c2c(C)c(-n3nccn3)sc21)c1cc(F)ccc1OC |
| InChI | InChI=1S/C28H32FN5O6S/c1-6-8-14-40-27(36)18(4)33-24(35)23-17(3)25(34-30-11-12-31-34)41-26(23)32(28(33)37)16-22(39-13-7-2)20-15-19(29)9-10-21(20)38-5/h7,9-12,15,18,22H,2,6,8,13-14,16H2,1,3-5H3/t18?,22-/m0/s1 |
| InChIKey | VSEHUQXNWWZLCE-YSYXNDDBSA-N |
| XLogP | 4.11 |
| TPSA | 119.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|