C18H26N2 — CID 129178399
(3Z,5Z)-2,2,5-trimethyl-N-[3-methyl-2-(methylideneamino)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-imine (PubChem CID 129178399) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (3Z,5Z)-2,2,5-trimethyl-N-[3-methyl-2-(methylideneamino)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-imine.
| Compound Name | (3Z,5Z)-2,2,5-trimethyl-N-[3-methyl-2-(methylideneamino)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 129178399 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (3Z,5Z)-2,2,5-trimethyl-N-[3-methyl-2-(methylideneamino)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-imine |
| SMILES | C=NC1=C(/N=C/C(C)(C)/C=C\C(C)=C/C)C=CCC1C |
| InChI | InChI=1S/C18H26N2/c1-7-14(2)11-12-18(4,5)13-20-16-10-8-9-15(3)17(16)19-6/h7-8,10-13,15H,6,9H2,1-5H3/b12-11-,14-7-,20-13+ |
| InChIKey | CVPJMDSJYRPWAO-XNGKLDFKSA-N |
| XLogP | 5.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|