C30H40N2O4S — CID 129179273
(14R,18R)-4-[(4-aminophenyl)sulfanyl-methylamino]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one (PubChem CID 129179273) has the molecular formula C30H40N2O4S and a molecular weight of 524.73 g/mol. Its IUPAC name is (14R,18R)-4-[(4-aminophenyl)sulfanyl-methylamino]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one.
| Compound Name | (14R,18R)-4-[(4-aminophenyl)sulfanyl-methylamino]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
|---|---|
| PubChem CID | 129179273 |
| Molecular Formula | C30H40N2O4S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | (14R,18R)-4-[(4-aminophenyl)sulfanyl-methylamino]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
| SMILES | CC1=CC23C(=O)C(C=C4COC(C)(C)OC4C2(O)C1N(C)Sc1ccc(N)cc1)[C@H]1C(C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H40N2O4S/c1-16-14-29-17(2)12-22-23(27(22,3)4)21(25(29)33)13-18-15-35-28(5,6)36-26(18)30(29,34)24(16)32(7)37-20-10-8-19(31)9-11-20/h8-11,13-14,17,21-24,26,34H,12,15,31H2,1-7H3/t17-,21?,22?,23+,24?,26?,29?,30?/m1/s1 |
| InChIKey | YQAVZJKLGDNOHB-JTZLXWKZSA-N |
| XLogP | 4.84 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|