C20H17ClFN5O3 — CID 129179513
7-(3-chloro-4-nitrophenyl)-N-(3-fluoro-4-methoxyphenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 129179513) has the molecular formula C20H17ClFN5O3 and a molecular weight of 429.84 g/mol. Its IUPAC name is 7-(3-chloro-4-nitrophenyl)-N-(3-fluoro-4-methoxyphenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 7-(3-chloro-4-nitrophenyl)-N-(3-fluoro-4-methoxyphenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129179513 |
| Molecular Formula | C20H17ClFN5O3 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 7-(3-chloro-4-nitrophenyl)-N-(3-fluoro-4-methoxyphenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ncnc3c2CCN(c2ccc([N+](=O)[O-])c(Cl)c2)C3)cc1F |
| InChI | InChI=1S/C20H17ClFN5O3/c1-30-19-5-2-12(8-16(19)22)25-20-14-6-7-26(10-17(14)23-11-24-20)13-3-4-18(27(28)29)15(21)9-13/h2-5,8-9,11H,6-7,10H2,1H3,(H,23,24,25) |
| InChIKey | OEYKBTBAYGRNKA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|