C29H29N3O4 — CID 129180028
4-[(2S,3R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129180028) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-[(2S,3R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129180028 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 4-[(2S,3R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)C(CN3CCCC3)C(c3ccccc3)C1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C29H29N3O4/c1-35-23-16-31-17-24-26(23)28(34)27(33)22(18-32-13-5-6-14-32)25(20-7-3-2-4-8-20)29(28,36-24)21-11-9-19(15-30)10-12-21/h2-4,7-12,16-17,22,25,27,33-34H,5-6,13-14,18H2,1H3/t22?,25?,27-,28+,29?/m1/s1 |
| InChIKey | QUWLERJQXUSKIV-OIIDBTIASA-N |
| XLogP | 3.31 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |