C25H22BrClN2O4 — CID 129180083
(2S,3R,11S,12R,13S)-3-(4-bromophenyl)-7-chloro-9-methoxy-15-methyl-4-oxa-8,15-diazapentacyclo[14.3.1.02,13.03,11.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,12-diol (PubChem CID 129180083) has the molecular formula C25H22BrClN2O4 and a molecular weight of 529.82 g/mol. Its IUPAC name is (2S,3R,11S,12R,13S)-3-(4-bromophenyl)-7-chloro-9-methoxy-15-methyl-4-oxa-8,15-diazapentacyclo[14.3.1.02,13.03,11.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,12-diol.
| Compound Name | (2S,3R,11S,12R,13S)-3-(4-bromophenyl)-7-chloro-9-methoxy-15-methyl-4-oxa-8,15-diazapentacyclo[14.3.1.02,13.03,11.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,12-diol |
|---|---|
| PubChem CID | 129180083 |
| Molecular Formula | C25H22BrClN2O4 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | (2S,3R,11S,12R,13S)-3-(4-bromophenyl)-7-chloro-9-methoxy-15-methyl-4-oxa-8,15-diazapentacyclo[14.3.1.02,13.03,11.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,12-diol |
| SMILES | COc1nc(Cl)cc2c1[C@]1(O)[C@H](O)[C@@H]3CN(C)c4cccc(c4)[C@H]3[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C25H22BrClN2O4/c1-29-12-17-20(13-4-3-5-16(29)10-13)25(14-6-8-15(26)9-7-14)24(31,22(17)30)21-18(33-25)11-19(27)28-23(21)32-2/h3-11,17,20,22,30-31H,12H2,1-2H3/t17-,20-,22-,24+,25+/m1/s1 |
| InChIKey | OGSQZNBTRIIDAZ-UUZKZGARSA-N |
| XLogP | 4.21 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|