About bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane
bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane (PubChem CID 129180180) has the molecular formula C4H10Br2
and a molecular weight of 222.94 g/mol. Its IUPAC name is bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane.
Molecular Properties
| Compound Name | bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane |
| PubChem CID | 129180180 |
| Molecular Formula | C4H10Br2 |
| Molecular Weight | 222.94 g/mol |
| Exact Mass | 220.94 |
| IUPAC Name | bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane |
| SMILES | [13CH3][13CH2]Br.[2H]C([2H])([2H])CBr |
| InChI | InChI=1S/2C2H5Br/c2*1-2-3/h2*2H2,1H3/i1+1,2+1;1D3 |
| InChIKey | XJGCEMIMYVXCTC-MKEHKGSFSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane?
The IUPAC name of bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane (CID 129180180) is bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane.
What is the SMILES notation for bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane?
The canonical SMILES for bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane is [13CH3][13CH2]Br.[2H]C([2H])([2H])CBr.
What is the InChIKey of bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane?
The InChIKey is XJGCEMIMYVXCTC-MKEHKGSFSA-N. The full InChI is InChI=1S/2C2H5Br/c2*1-2-3/h2*2H2,1H3/i1+1,2+1;1D3.
What are the key properties of bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane?
bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane has a molecular weight of 222.94 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(1,2-13C2)ethane;2-bromo-1,1,1-trideuterioethane is sourced from PubChem (CID 129180180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).