About N-methoxy-N-methyl-1,2,4-triazol-1-amine
N-methoxy-N-methyl-1,2,4-triazol-1-amine (PubChem CID 129180329) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is N-methoxy-N-methyl-1,2,4-triazol-1-amine.
Molecular Properties
| Compound Name | N-methoxy-N-methyl-1,2,4-triazol-1-amine |
| PubChem CID | 129180329 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | N-methoxy-N-methyl-1,2,4-triazol-1-amine |
| SMILES | CON(C)n1cncn1 |
| InChI | InChI=1S/C4H8N4O/c1-7(9-2)8-4-5-3-6-8/h3-4H,1-2H3 |
| InChIKey | BSQUCRQGFDYRQV-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methyl-1,2,4-triazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methyl-1,2,4-triazol-1-amine?
The IUPAC name of N-methoxy-N-methyl-1,2,4-triazol-1-amine (CID 129180329) is N-methoxy-N-methyl-1,2,4-triazol-1-amine.
What is the SMILES notation for N-methoxy-N-methyl-1,2,4-triazol-1-amine?
The canonical SMILES for N-methoxy-N-methyl-1,2,4-triazol-1-amine is CON(C)n1cncn1.
What is the InChIKey of N-methoxy-N-methyl-1,2,4-triazol-1-amine?
The InChIKey is BSQUCRQGFDYRQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c1-7(9-2)8-4-5-3-6-8/h3-4H,1-2H3.
What are the key properties of N-methoxy-N-methyl-1,2,4-triazol-1-amine?
N-methoxy-N-methyl-1,2,4-triazol-1-amine has a molecular weight of 128.13 g/mol, XLogP of -0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methyl-1,2,4-triazol-1-amine is sourced from PubChem (CID 129180329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).