About 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol
1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol (PubChem CID 129180563) has the molecular formula C12H16FN3O
and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol |
| PubChem CID | 129180563 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol |
| SMILES | Cc1cc2nnn(CC(C)(C)O)c2c(C)c1F |
| InChI | InChI=1S/C12H16FN3O/c1-7-5-9-11(8(2)10(7)13)16(15-14-9)6-12(3,4)17/h5,17H,6H2,1-4H3 |
| InChIKey | RXKYSCCHPIKXCF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol?
The IUPAC name of 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol (CID 129180563) is 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol.
What is the SMILES notation for 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol?
The canonical SMILES for 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol is Cc1cc2nnn(CC(C)(C)O)c2c(C)c1F.
What is the InChIKey of 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol?
The InChIKey is RXKYSCCHPIKXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN3O/c1-7-5-9-11(8(2)10(7)13)16(15-14-9)6-12(3,4)17/h5,17H,6H2,1-4H3.
What are the key properties of 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol?
1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol has a molecular weight of 237.28 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluoro-5,7-dimethylbenzotriazol-1-yl)-2-methylpropan-2-ol is sourced from PubChem (CID 129180563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).